C26H46OS — CID 144731860
1-methoxysulfanyl-4-(7,11,15-trimethylhexadecan-2-yl)benzene (PubChem CID 144731860) has the molecular formula C26H46OS and a molecular weight of 406.72 g/mol. Its IUPAC name is 1-methoxysulfanyl-4-(7,11,15-trimethylhexadecan-2-yl)benzene.
| Compound Name | 1-methoxysulfanyl-4-(7,11,15-trimethylhexadecan-2-yl)benzene |
|---|---|
| PubChem CID | 144731860 |
| Molecular Formula | C26H46OS |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | 1-methoxysulfanyl-4-(7,11,15-trimethylhexadecan-2-yl)benzene |
| SMILES | COSc1ccc(C(C)CCCCC(C)CCCC(C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C26H46OS/c1-21(2)11-9-13-23(4)15-10-14-22(3)12-7-8-16-24(5)25-17-19-26(20-18-25)28-27-6/h17-24H,7-16H2,1-6H3 |
| InChIKey | QABLLJSZDREKNJ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|