C24H44S3 — CID 101430290
3,4-bis[[(3S)-3,7-dimethyloctyl]sulfanyl]thiophene (PubChem CID 101430290) has the molecular formula C24H44S3 and a molecular weight of 428.82 g/mol. Its IUPAC name is 3,4-bis[[(3S)-3,7-dimethyloctyl]sulfanyl]thiophene.
| Compound Name | 3,4-bis[[(3S)-3,7-dimethyloctyl]sulfanyl]thiophene |
|---|---|
| PubChem CID | 101430290 |
| Molecular Formula | C24H44S3 |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 3,4-bis[[(3S)-3,7-dimethyloctyl]sulfanyl]thiophene |
| SMILES | CC(C)CCC[C@H](C)CCSc1cscc1SCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C24H44S3/c1-19(2)9-7-11-21(5)13-15-26-23-17-25-18-24(23)27-16-14-22(6)12-8-10-20(3)4/h17-22H,7-16H2,1-6H3/t21-,22-/m0/s1 |
| InChIKey | USBBBCDLOSZMAX-VXKWHMMOSA-N |
| XLogP | 9.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |