About N'-trityloxyethanimidamide;hydrochloride
N'-trityloxyethanimidamide;hydrochloride (PubChem CID 54600706) has the molecular formula C21H21ClN2O
and a molecular weight of 352.87 g/mol. Its IUPAC name is N'-trityloxyethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-trityloxyethanimidamide;hydrochloride |
| PubChem CID | 54600706 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N'-trityloxyethanimidamide;hydrochloride |
| SMILES | C/C(N)=N/OC(c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H20N2O.ClH/c1-17(22)23-24-21(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3,(H2,22,23);1H |
| InChIKey | AXNNHDMRRUKVAK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N'-trityloxyethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-trityloxyethanimidamide;hydrochloride?
The IUPAC name of N'-trityloxyethanimidamide;hydrochloride (CID 54600706) is N'-trityloxyethanimidamide;hydrochloride.
What is the SMILES notation for N'-trityloxyethanimidamide;hydrochloride?
The canonical SMILES for N'-trityloxyethanimidamide;hydrochloride is C/C(N)=N/OC(c1ccccc1)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of N'-trityloxyethanimidamide;hydrochloride?
The InChIKey is AXNNHDMRRUKVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O.ClH/c1-17(22)23-24-21(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3,(H2,22,23);1H.
What are the key properties of N'-trityloxyethanimidamide;hydrochloride?
N'-trityloxyethanimidamide;hydrochloride has a molecular weight of 352.87 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-trityloxyethanimidamide;hydrochloride is sourced from PubChem (CID 54600706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).