C32H23Cl2NO — CID 163288845
N-[bis(4-chlorophenyl)-phenylmethoxy]-1,1-diphenylmethanimine (PubChem CID 163288845) has the molecular formula C32H23Cl2NO and a molecular weight of 508.45 g/mol. Its IUPAC name is N-[bis(4-chlorophenyl)-phenylmethoxy]-1,1-diphenylmethanimine.
| Compound Name | N-[bis(4-chlorophenyl)-phenylmethoxy]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 163288845 |
| Molecular Formula | C32H23Cl2NO |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[bis(4-chlorophenyl)-phenylmethoxy]-1,1-diphenylmethanimine |
| SMILES | Clc1ccc(C(ON=C(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H23Cl2NO/c33-29-20-16-27(17-21-29)32(26-14-8-3-9-15-26,28-18-22-30(34)23-19-28)36-35-31(24-10-4-1-5-11-24)25-12-6-2-7-13-25/h1-23H |
| InChIKey | XPRRITPJUVEVKW-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|