About bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+)
bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) (PubChem CID 54601709) has the molecular formula C24H18Br2MnN6O2
and a molecular weight of 637.19 g/mol. Its IUPAC name is bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+).
Molecular Properties
| Compound Name | bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) |
| PubChem CID | 54601709 |
| Molecular Formula | C24H18Br2MnN6O2 |
| Molecular Weight | 637.19 g/mol |
| Exact Mass | 634.92 |
| IUPAC Name | bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) |
| SMILES | [Mn+2].[O-]c1cc(Br)ccc1/C=N/Nc1ccccn1.[O-]c1cc(Br)ccc1/C=N/Nc1ccccn1 |
| InChI | InChI=1S/2C12H10BrN3O.Mn/c2*13-10-5-4-9(11(17)7-10)8-15-16-12-3-1-2-6-14-12;/h2*1-8,17H,(H,14,16);/q;;+2/p-2/b2*15-8+; |
| InChIKey | NXBXTQISFOXSON-ILRJJWRASA-L |
| XLogP | 4.72 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 637.19 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+)?
The IUPAC name of bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) (CID 54601709) is bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+).
What is the SMILES notation for bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+)?
The canonical SMILES for bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) is [Mn+2].[O-]c1cc(Br)ccc1/C=N/Nc1ccccn1.[O-]c1cc(Br)ccc1/C=N/Nc1ccccn1.
What is the InChIKey of bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+)?
The InChIKey is NXBXTQISFOXSON-ILRJJWRASA-L. The full InChI is InChI=1S/2C12H10BrN3O.Mn/c2*13-10-5-4-9(11(17)7-10)8-15-16-12-3-1-2-6-14-12;/h2*1-8,17H,(H,14,16);/q;;+2/p-2/b2*15-8+;.
What are the key properties of bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+)?
bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) has a molecular weight of 637.19 g/mol, XLogP of 4.72, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-bromo-2-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenolate);manganese(2+) is sourced from PubChem (CID 54601709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).