C12H15N3OS — CID 54602926
[(E)-1-(3,4-dihydro-1H-isochromen-1-yl)ethylideneamino]thiourea (PubChem CID 54602926) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is [(E)-1-(3,4-dihydro-1H-isochromen-1-yl)ethylideneamino]thiourea.
| Compound Name | [(E)-1-(3,4-dihydro-1H-isochromen-1-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 54602926 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [(E)-1-(3,4-dihydro-1H-isochromen-1-yl)ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)C1OCCc2ccccc21 |
| InChI | InChI=1S/C12H15N3OS/c1-8(14-15-12(13)17)11-10-5-3-2-4-9(10)6-7-16-11/h2-5,11H,6-7H2,1H3,(H3,13,15,17)/b14-8+ |
| InChIKey | GQNZGLSYIQELPG-RIYZIHGNSA-N |
| XLogP | 1.51 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|