C7H13ClN6O — CID 54604744
2-[3-(2-amino-1H-imidazol-5-yl)-3-oxopropyl]guanidine;hydrochloride (PubChem CID 54604744) has the molecular formula C7H13ClN6O and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-[3-(2-amino-1H-imidazol-5-yl)-3-oxopropyl]guanidine;hydrochloride.
| Compound Name | 2-[3-(2-amino-1H-imidazol-5-yl)-3-oxopropyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 54604744 |
| Molecular Formula | C7H13ClN6O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-[3-(2-amino-1H-imidazol-5-yl)-3-oxopropyl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=NCCC(=O)c1cnc(N)[nH]1 |
| InChI | InChI=1S/C7H12N6O.ClH/c8-6(9)11-2-1-5(14)4-3-12-7(10)13-4;/h3H,1-2H2,(H4,8,9,11)(H3,10,12,13);1H |
| InChIKey | UDNIGSNBYXFRNP-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 136.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|