C31H32MnN2O9+2 — CID 54605162
2-hydroxybenzoic acid;manganese(2+);3-(1-methylpyrrolidin-2-yl)pyridine;bis(2-oxoniobenzoate) (PubChem CID 54605162) has the molecular formula C31H32MnN2O9+2 and a molecular weight of 631.54 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;manganese(2+);3-(1-methylpyrrolidin-2-yl)pyridine;bis(2-oxoniobenzoate).
| Compound Name | 2-hydroxybenzoic acid;manganese(2+);3-(1-methylpyrrolidin-2-yl)pyridine;bis(2-oxoniobenzoate) |
|---|---|
| PubChem CID | 54605162 |
| Molecular Formula | C31H32MnN2O9+2 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | 2-hydroxybenzoic acid;manganese(2+);3-(1-methylpyrrolidin-2-yl)pyridine;bis(2-oxoniobenzoate) |
| SMILES | CN1CCCC1c1cccnc1.O=C(O)c1ccccc1O.O=C([O-])c1ccccc1[OH2+].O=C([O-])c1ccccc1[OH2+].[Mn+2] |
| InChI | InChI=1S/C10H14N2.3C7H6O3.Mn/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;3*8-6-4-2-1-3-5(6)7(9)10;/h2,4,6,8,10H,3,5,7H2,1H3;3*1-4,8H,(H,9,10);/q;;;;+2 |
| InChIKey | QWRJNWCHYPGFDW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|