About (4-chlorophenyl)arsonic acid;oxozirconium
(4-chlorophenyl)arsonic acid;oxozirconium (PubChem CID 54605477) has the molecular formula C6H6AsClO4Zr
and a molecular weight of 343.71 g/mol. Its IUPAC name is (4-chlorophenyl)arsonic acid;oxozirconium.
Molecular Properties
| Compound Name | (4-chlorophenyl)arsonic acid;oxozirconium |
| PubChem CID | 54605477 |
| Molecular Formula | C6H6AsClO4Zr |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 341.82 |
| IUPAC Name | (4-chlorophenyl)arsonic acid;oxozirconium |
| SMILES | O=[As](O)(O)c1ccc(Cl)cc1.O=[Zr] |
| InChI | InChI=1S/C6H6AsClO3.O.Zr/c8-6-3-1-5(2-4-6)7(9,10)11;;/h1-4H,(H2,9,10,11);; |
| InChIKey | GYZOWFVVBCPVHE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)arsonic acid;oxozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)arsonic acid;oxozirconium?
The IUPAC name of (4-chlorophenyl)arsonic acid;oxozirconium (CID 54605477) is (4-chlorophenyl)arsonic acid;oxozirconium.
What is the SMILES notation for (4-chlorophenyl)arsonic acid;oxozirconium?
The canonical SMILES for (4-chlorophenyl)arsonic acid;oxozirconium is O=[As](O)(O)c1ccc(Cl)cc1.O=[Zr].
What is the InChIKey of (4-chlorophenyl)arsonic acid;oxozirconium?
The InChIKey is GYZOWFVVBCPVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6AsClO3.O.Zr/c8-6-3-1-5(2-4-6)7(9,10)11;;/h1-4H,(H2,9,10,11);;.
What are the key properties of (4-chlorophenyl)arsonic acid;oxozirconium?
(4-chlorophenyl)arsonic acid;oxozirconium has a molecular weight of 343.71 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)arsonic acid;oxozirconium is sourced from PubChem (CID 54605477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).