About Trioxidophosphate(.2-)
Trioxidophosphate(.2-) (PubChem CID 5460552) has the molecular formula O3P-2
and a molecular weight of 78.97 g/mol.
Molecular Properties
| Compound Name | Trioxidophosphate(.2-) |
| PubChem CID | 5460552 |
| Molecular Formula | O3P-2 |
| Molecular Weight | 78.97 g/mol |
| Exact Mass | 78.96 |
| IUPAC Name | — |
| SMILES | [O]P([O-])[O-] |
| InChI | InChI=1S/O3P/c1-4(2)3/q-2 |
| InChIKey | UVQGZXCFEVOXIZ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 66.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.97 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Trioxidophosphate(.2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Trioxidophosphate(.2-)?
The IUPAC name of Trioxidophosphate(.2-) (CID 5460552) is not available.
What is the SMILES notation for Trioxidophosphate(.2-)?
The canonical SMILES for Trioxidophosphate(.2-) is [O]P([O-])[O-].
What is the InChIKey of Trioxidophosphate(.2-)?
The InChIKey is UVQGZXCFEVOXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/O3P/c1-4(2)3/q-2.
What are the key properties of Trioxidophosphate(.2-)?
Trioxidophosphate(.2-) has a molecular weight of 78.97 g/mol, XLogP of -1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Trioxidophosphate(.2-) is sourced from PubChem (CID 5460552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).