C9H13IN4O3S — CID 54605822
propyl N'-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamimidothioate;hydroiodide (PubChem CID 54605822) has the molecular formula C9H13IN4O3S and a molecular weight of 384.20 g/mol. Its IUPAC name is propyl N'-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamimidothioate;hydroiodide.
| Compound Name | propyl N'-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 54605822 |
| Molecular Formula | C9H13IN4O3S |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | propyl N'-[(E)-(5-nitrofuran-2-yl)methylideneamino]carbamimidothioate;hydroiodide |
| SMILES | CCCS/C(N)=N/N=C/c1ccc([N+](=O)[O-])o1.I |
| InChI | InChI=1S/C9H12N4O3S.HI/c1-2-5-17-9(10)12-11-6-7-3-4-8(16-7)13(14)15;/h3-4,6H,2,5H2,1H3,(H2,10,12);1H/b11-6+; |
| InChIKey | FXHLYPQIMGDEGA-ICSBZGNSSA-N |
| XLogP | 2.60 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|