C15H21ClN6 — CID 54606002
2-[2-(dimethylamino)ethyl]-1,3-dipyridin-2-ylguanidine;hydrochloride (PubChem CID 54606002) has the molecular formula C15H21ClN6 and a molecular weight of 320.83 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-1,3-dipyridin-2-ylguanidine;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethyl]-1,3-dipyridin-2-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 54606002 |
| Molecular Formula | C15H21ClN6 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-1,3-dipyridin-2-ylguanidine;hydrochloride |
| SMILES | CN(C)CCN=C(Nc1ccccn1)Nc1ccccn1.Cl |
| InChI | InChI=1S/C15H20N6.ClH/c1-21(2)12-11-18-15(19-13-7-3-5-9-16-13)20-14-8-4-6-10-17-14;/h3-10H,11-12H2,1-2H3,(H2,16,17,18,19,20);1H |
| InChIKey | UBWCLENYGVSPTG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|