About barium(2+);2-phosphonooxyprop-2-enoic acid;silver
barium(2+);2-phosphonooxyprop-2-enoic acid;silver (PubChem CID 54606075) has the molecular formula C3H5AgBaO6P+2
and a molecular weight of 413.24 g/mol. Its IUPAC name is barium(2+);2-phosphonooxyprop-2-enoic acid;silver.
Molecular Properties
| Compound Name | barium(2+);2-phosphonooxyprop-2-enoic acid;silver |
| PubChem CID | 54606075 |
| Molecular Formula | C3H5AgBaO6P+2 |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.79 |
| IUPAC Name | barium(2+);2-phosphonooxyprop-2-enoic acid;silver |
| SMILES | C=C(OP(=O)(O)O)C(=O)O.[Ag].[Ba+2] |
| InChI | InChI=1S/C3H5O6P.Ag.Ba/c1-2(3(4)5)9-10(6,7)8;;/h1H2,(H,4,5)(H2,6,7,8);;/q;;+2 |
| InChIKey | PWPKDAUETDWMHX-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);2-phosphonooxyprop-2-enoic acid;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-phosphonooxyprop-2-enoic acid;silver?
The IUPAC name of barium(2+);2-phosphonooxyprop-2-enoic acid;silver (CID 54606075) is barium(2+);2-phosphonooxyprop-2-enoic acid;silver.
What is the SMILES notation for barium(2+);2-phosphonooxyprop-2-enoic acid;silver?
The canonical SMILES for barium(2+);2-phosphonooxyprop-2-enoic acid;silver is C=C(OP(=O)(O)O)C(=O)O.[Ag].[Ba+2].
What is the InChIKey of barium(2+);2-phosphonooxyprop-2-enoic acid;silver?
The InChIKey is PWPKDAUETDWMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5O6P.Ag.Ba/c1-2(3(4)5)9-10(6,7)8;;/h1H2,(H,4,5)(H2,6,7,8);;/q;;+2.
What are the key properties of barium(2+);2-phosphonooxyprop-2-enoic acid;silver?
barium(2+);2-phosphonooxyprop-2-enoic acid;silver has a molecular weight of 413.24 g/mol, XLogP of -0.69, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-phosphonooxyprop-2-enoic acid;silver is sourced from PubChem (CID 54606075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).