C18H18IN3O — CID 54609935
6-[(E)-2-(1H-indol-3-yl)ethenyl]-N,1-dimethylpyridin-1-ium-3-carboxamide iodide (PubChem CID 54609935) has the molecular formula C18H18IN3O and a molecular weight of 419.27 g/mol. Its IUPAC name is 6-[(E)-2-(1H-indol-3-yl)ethenyl]-N,1-dimethylpyridin-1-ium-3-carboxamide iodide.
| Compound Name | 6-[(E)-2-(1H-indol-3-yl)ethenyl]-N,1-dimethylpyridin-1-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 54609935 |
| Molecular Formula | C18H18IN3O |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 6-[(E)-2-(1H-indol-3-yl)ethenyl]-N,1-dimethylpyridin-1-ium-3-carboxamide iodide |
| SMILES | CNC(=O)c1ccc(/C=C/c2c[nH]c3ccccc23)[n+](C)c1.[I-] |
| InChI | InChI=1S/C18H17N3O.HI/c1-19-18(22)14-8-10-15(21(2)12-14)9-7-13-11-20-17-6-4-3-5-16(13)17;/h3-12H,1-2H3,(H,19,22);1H |
| InChIKey | LPHQMOSSVLRIOP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|