C20H24Br3N2O2+ — CID 54612213
1,10-bis(2-bromopyridin-1-ium-1-yl)decane-2,9-dione bromide (PubChem CID 54612213) has the molecular formula C20H24Br3N2O2+ and a molecular weight of 564.14 g/mol. Its IUPAC name is 1,10-bis(2-bromopyridin-1-ium-1-yl)decane-2,9-dione bromide.
| Compound Name | 1,10-bis(2-bromopyridin-1-ium-1-yl)decane-2,9-dione bromide |
|---|---|
| PubChem CID | 54612213 |
| Molecular Formula | C20H24Br3N2O2+ |
| Molecular Weight | 564.14 g/mol |
| Exact Mass | 560.94 |
| IUPAC Name | 1,10-bis(2-bromopyridin-1-ium-1-yl)decane-2,9-dione bromide |
| SMILES | O=C(CCCCCCC(=O)C[n+]1ccccc1Br)C[n+]1ccccc1Br.[Br-] |
| InChI | InChI=1S/C20H24Br2N2O2.BrH/c21-19-11-5-7-13-23(19)15-17(25)9-3-1-2-4-10-18(26)16-24-14-8-6-12-20(24)22;/h5-8,11-14H,1-4,9-10,15-16H2;1H/q+2;/p-1 |
| InChIKey | GZKZBYPOXQGZTR-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|