C30H36N2O7S2 — CID 54620830
N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylbenzenesulfonamide (PubChem CID 54620830) has the molecular formula C30H36N2O7S2 and a molecular weight of 600.76 g/mol. Its IUPAC name is N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54620830 |
| Molecular Formula | C30H36N2O7S2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-[(E)-2-phenylethenyl]-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)N(C)C[C@H]1Oc2cc(/C=C/c3ccccc3)ccc2S(=O)(=O)N([C@@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C30H36N2O7S2/c1-22-19-32(23(2)21-33)41(36,37)30-17-16-25(15-14-24-10-6-5-7-11-24)18-27(30)39-28(22)20-31(3)40(34,35)29-13-9-8-12-26(29)38-4/h5-18,22-23,28,33H,19-21H2,1-4H3/b15-14+/t22-,23+,28-/m1/s1 |
| InChIKey | GOCGMTNLDLJOTG-CIPLSMMKSA-N |
| XLogP | 3.95 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|