C12H23Cl — CID 5462856
(E)-1-chloro-5,5,7,7-tetramethyloct-2-ene (PubChem CID 5462856) has the molecular formula C12H23Cl and a molecular weight of 202.77 g/mol. Its IUPAC name is (E)-1-chloro-5,5,7,7-tetramethyloct-2-ene.
| Compound Name | (E)-1-chloro-5,5,7,7-tetramethyloct-2-ene |
|---|---|
| PubChem CID | 5462856 |
| Molecular Formula | C12H23Cl |
| Molecular Weight | 202.77 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (E)-1-chloro-5,5,7,7-tetramethyloct-2-ene |
| SMILES | CC(C)(C)CC(C)(C)C/C=C/CCl |
| InChI | InChI=1S/C12H23Cl/c1-11(2,3)10-12(4,5)8-6-7-9-13/h6-7H,8-10H2,1-5H3/b7-6+ |
| InChIKey | DVOYYVNTAWFQAV-VOTSOKGWSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.77 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|