C15H16FNO5 — CID 54638737
2-[(2R,3R,6S)-3-[(2-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetic acid (PubChem CID 54638737) has the molecular formula C15H16FNO5 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-3-[(2-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetic acid.
| Compound Name | 2-[(2R,3R,6S)-3-[(2-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetic acid |
|---|---|
| PubChem CID | 54638737 |
| Molecular Formula | C15H16FNO5 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[(2R,3R,6S)-3-[(2-fluorobenzoyl)amino]-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1C=C[C@@H](NC(=O)c2ccccc2F)[C@H](CO)O1 |
| InChI | InChI=1S/C15H16FNO5/c16-11-4-2-1-3-10(11)15(21)17-12-6-5-9(7-14(19)20)22-13(12)8-18/h1-6,9,12-13,18H,7-8H2,(H,17,21)(H,19,20)/t9-,12-,13+/m1/s1 |
| InChIKey | QPJNNDOFKLWHFX-WQAKAFBOSA-N |
| XLogP | 0.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|