C20H32N4O4 — CID 54640055
N-[3-(dimethylamino)propyl]-2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[(2-pyridin-3-ylacetyl)amino]oxan-2-yl]acetamide (PubChem CID 54640055) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[(2-pyridin-3-ylacetyl)amino]oxan-2-yl]acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[(2-pyridin-3-ylacetyl)amino]oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 54640055 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[(2R,5R,6R)-6-(hydroxymethyl)-5-[(2-pyridin-3-ylacetyl)amino]oxan-2-yl]acetamide |
| SMILES | CN(C)CCCNC(=O)C[C@H]1CC[C@@H](NC(=O)Cc2cccnc2)[C@H](CO)O1 |
| InChI | InChI=1S/C20H32N4O4/c1-24(2)10-4-9-22-19(26)12-16-6-7-17(18(14-25)28-16)23-20(27)11-15-5-3-8-21-13-15/h3,5,8,13,16-18,25H,4,6-7,9-12,14H2,1-2H3,(H,22,26)(H,23,27)/t16-,17-,18+/m1/s1 |
| InChIKey | IHGRXRHOBYYXJU-KURKYZTESA-N |
| XLogP | 0.11 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|