C17H32N4O4 — CID 54641014
N-[3-(dimethylamino)propyl]-2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(propan-2-ylcarbamoylamino)-3,6-dihydro-2H-pyran-6-yl]acetamide (PubChem CID 54641014) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(propan-2-ylcarbamoylamino)-3,6-dihydro-2H-pyran-6-yl]acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(propan-2-ylcarbamoylamino)-3,6-dihydro-2H-pyran-6-yl]acetamide |
|---|---|
| PubChem CID | 54641014 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[(2S,3S,6R)-2-(hydroxymethyl)-3-(propan-2-ylcarbamoylamino)-3,6-dihydro-2H-pyran-6-yl]acetamide |
| SMILES | CC(C)NC(=O)N[C@H]1C=C[C@@H](CC(=O)NCCCN(C)C)O[C@@H]1CO |
| InChI | InChI=1S/C17H32N4O4/c1-12(2)19-17(24)20-14-7-6-13(25-15(14)11-22)10-16(23)18-8-5-9-21(3)4/h6-7,12-15,22H,5,8-11H2,1-4H3,(H,18,23)(H2,19,20,24)/t13-,14-,15+/m0/s1 |
| InChIKey | LJGUQBBKFZFLJA-SOUVJXGZSA-N |
| XLogP | -0.16 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|