C9H14N2O3 — CID 546469
1-(2,2-dimethylpropyl)-3-methylimidazolidine-2,4,5-trione (PubChem CID 546469) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-methylimidazolidine-2,4,5-trione.
| Compound Name | 1-(2,2-dimethylpropyl)-3-methylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 546469 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-methylimidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(CC(C)(C)C)C1=O |
| InChI | InChI=1S/C9H14N2O3/c1-9(2,3)5-11-7(13)6(12)10(4)8(11)14/h5H2,1-4H3 |
| InChIKey | XUAQMWAUGSLKFF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|