C22H26N2O3 — CID 54650282
(2R,3S,4S)-4-(hydroxymethyl)-1-(oxane-4-carbonyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile (PubChem CID 54650282) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2R,3S,4S)-4-(hydroxymethyl)-1-(oxane-4-carbonyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile.
| Compound Name | (2R,3S,4S)-4-(hydroxymethyl)-1-(oxane-4-carbonyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile |
|---|---|
| PubChem CID | 54650282 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (2R,3S,4S)-4-(hydroxymethyl)-1-(oxane-4-carbonyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile |
| SMILES | CCCC#Cc1ccc([C@@H]2[C@@H](CO)N(C(=O)C3CCOCC3)[C@H]2C#N)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-2-3-4-5-16-6-8-17(9-7-16)21-19(14-23)24(20(21)15-25)22(26)18-10-12-27-13-11-18/h6-9,18-21,25H,2-3,10-13,15H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | NAAUMJMVSZXHSJ-HBMCJLEFSA-N |
| XLogP | 2.44 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|