C22H26N2O2 — CID 54651153
(2S,3S,4S)-1-(cyclopentanecarbonyl)-4-(hydroxymethyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile (PubChem CID 54651153) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2S,3S,4S)-1-(cyclopentanecarbonyl)-4-(hydroxymethyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile.
| Compound Name | (2S,3S,4S)-1-(cyclopentanecarbonyl)-4-(hydroxymethyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile |
|---|---|
| PubChem CID | 54651153 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2S,3S,4S)-1-(cyclopentanecarbonyl)-4-(hydroxymethyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile |
| SMILES | CCCC#Cc1ccc([C@H]2[C@@H](C#N)N(C(=O)C3CCCC3)[C@@H]2CO)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-3-4-7-16-10-12-17(13-11-16)21-19(14-23)24(20(21)15-25)22(26)18-8-5-6-9-18/h10-13,18-21,25H,2-3,5-6,8-9,15H2,1H3/t19-,20-,21+/m1/s1 |
| InChIKey | DRYQKBTZNUWAKS-NJYVYQBISA-N |
| XLogP | 3.21 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|