C22H27N3O3 — CID 54650413
(2R,3S,4S)-4-(hydroxymethyl)-1-(2-morpholin-4-ylacetyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile (PubChem CID 54650413) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (2R,3S,4S)-4-(hydroxymethyl)-1-(2-morpholin-4-ylacetyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile.
| Compound Name | (2R,3S,4S)-4-(hydroxymethyl)-1-(2-morpholin-4-ylacetyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile |
|---|---|
| PubChem CID | 54650413 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (2R,3S,4S)-4-(hydroxymethyl)-1-(2-morpholin-4-ylacetyl)-3-(4-pent-1-ynylphenyl)azetidine-2-carbonitrile |
| SMILES | CCCC#Cc1ccc([C@@H]2[C@@H](CO)N(C(=O)CN3CCOCC3)[C@H]2C#N)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-2-3-4-5-17-6-8-18(9-7-17)22-19(14-23)25(20(22)16-26)21(27)15-24-10-12-28-13-11-24/h6-9,19-20,22,26H,2-3,10-13,15-16H2,1H3/t19-,20+,22-/m0/s1 |
| InChIKey | YXSDJPNZSPSDMY-VWPQPMDRSA-N |
| XLogP | 1.35 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|