C22H20N2O3S — CID 54650857
(2S,3R,4R)-1-(benzenesulfonyl)-3-[4-(2-cyclopropylethynyl)phenyl]-4-(hydroxymethyl)azetidine-2-carbonitrile (PubChem CID 54650857) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is (2S,3R,4R)-1-(benzenesulfonyl)-3-[4-(2-cyclopropylethynyl)phenyl]-4-(hydroxymethyl)azetidine-2-carbonitrile.
| Compound Name | (2S,3R,4R)-1-(benzenesulfonyl)-3-[4-(2-cyclopropylethynyl)phenyl]-4-(hydroxymethyl)azetidine-2-carbonitrile |
|---|---|
| PubChem CID | 54650857 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2S,3R,4R)-1-(benzenesulfonyl)-3-[4-(2-cyclopropylethynyl)phenyl]-4-(hydroxymethyl)azetidine-2-carbonitrile |
| SMILES | N#C[C@@H]1[C@@H](c2ccc(C#CC3CC3)cc2)[C@H](CO)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3S/c23-14-20-22(18-12-10-17(11-13-18)9-8-16-6-7-16)21(15-25)24(20)28(26,27)19-4-2-1-3-5-19/h1-5,10-13,16,20-22,25H,6-7,15H2/t20-,21+,22-/m1/s1 |
| InChIKey | HTSKYELAPRCAIC-BHIFYINESA-N |
| XLogP | 2.49 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|