C19H22N2O3S — CID 134830264
(2R,3R,4S)-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-1-methylsulfonylazetidine-2-carbonitrile (PubChem CID 134830264) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (2R,3R,4S)-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-1-methylsulfonylazetidine-2-carbonitrile.
| Compound Name | (2R,3R,4S)-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-1-methylsulfonylazetidine-2-carbonitrile |
|---|---|
| PubChem CID | 134830264 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2R,3R,4S)-3-[4-(2-cyclopentylethynyl)phenyl]-4-(hydroxymethyl)-1-methylsulfonylazetidine-2-carbonitrile |
| SMILES | CS(=O)(=O)N1[C@H](CO)[C@H](c2ccc(C#CC3CCCC3)cc2)[C@@H]1C#N |
| InChI | InChI=1S/C19H22N2O3S/c1-25(23,24)21-17(12-20)19(18(21)13-22)16-10-8-15(9-11-16)7-6-14-4-2-3-5-14/h8-11,14,17-19,22H,2-5,13H2,1H3/t17-,18+,19+/m0/s1 |
| InChIKey | JNKLWSMLSPYQEQ-IPMKNSEASA-N |
| XLogP | 1.84 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|