C24H29N3O6S — CID 54657353
2-[(2S,4aS,12aR)-8-(methanesulfonamido)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-benzylacetamide (PubChem CID 54657353) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-[(2S,4aS,12aR)-8-(methanesulfonamido)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-benzylacetamide.
| Compound Name | 2-[(2S,4aS,12aR)-8-(methanesulfonamido)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 54657353 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[(2S,4aS,12aR)-8-(methanesulfonamido)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-benzylacetamide |
| SMILES | CN1C(=O)c2cc(NS(C)(=O)=O)ccc2OC[C@@H]2O[C@H](CC(=O)NCc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C24H29N3O6S/c1-27-20-10-9-18(13-23(28)25-14-16-6-4-3-5-7-16)33-22(20)15-32-21-11-8-17(26-34(2,30)31)12-19(21)24(27)29/h3-8,11-12,18,20,22,26H,9-10,13-15H2,1-2H3,(H,25,28)/t18-,20-,22-/m0/s1 |
| InChIKey | SBKFHBFSQGWMKZ-VCOUNFBDSA-N |
| XLogP | 2.15 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |