C24H30N2O5 — CID 54658165
2-[(3R,6aR,8S,10aR)-3-hydroxy-1,2,3,4,6,6a,8,9,10,10a-decahydropyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide (PubChem CID 54658165) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-[(3R,6aR,8S,10aR)-3-hydroxy-1,2,3,4,6,6a,8,9,10,10a-decahydropyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(3R,6aR,8S,10aR)-3-hydroxy-1,2,3,4,6,6a,8,9,10,10a-decahydropyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54658165 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-[(3R,6aR,8S,10aR)-3-hydroxy-1,2,3,4,6,6a,8,9,10,10a-decahydropyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide |
| SMILES | O=C(C[C@@H]1CC[C@H]2NC[C@@H](O)COC[C@@H]2O1)NCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H30N2O5/c27-18-14-25-22-11-10-21(31-23(22)16-29-15-18)12-24(28)26-13-17-6-8-20(9-7-17)30-19-4-2-1-3-5-19/h1-9,18,21-23,25,27H,10-16H2,(H,26,28)/t18-,21+,22-,23+/m1/s1 |
| InChIKey | GATSYQQQECLMNC-MSYGRNIXSA-N |
| XLogP | 2.38 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |