C29H32N4O6 — CID 54658931
2-[(3R,6aS,8S,10aS)-3-hydroxy-1-(pyrazine-2-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide (PubChem CID 54658931) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[(3R,6aS,8S,10aS)-3-hydroxy-1-(pyrazine-2-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(3R,6aS,8S,10aS)-3-hydroxy-1-(pyrazine-2-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54658931 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[(3R,6aS,8S,10aS)-3-hydroxy-1-(pyrazine-2-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-[(4-phenoxyphenyl)methyl]acetamide |
| SMILES | O=C(C[C@@H]1CC[C@H]2[C@@H](COC[C@H](O)CN2C(=O)c2cnccn2)O1)NCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N4O6/c34-21-17-33(29(36)25-16-30-12-13-31-25)26-11-10-24(39-27(26)19-37-18-21)14-28(35)32-15-20-6-8-23(9-7-20)38-22-4-2-1-3-5-22/h1-9,12-13,16,21,24,26-27,34H,10-11,14-15,17-19H2,(H,32,35)/t21-,24+,26+,27-/m1/s1 |
| InChIKey | PYTZHGBIVUXMTM-JXHGYLODSA-N |
| XLogP | 2.72 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |