C23H33N3O6 — CID 54658373
2-[(3R,6aR,8S,10aR)-3-hydroxy-1-(oxane-4-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 54658373) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[(3R,6aR,8S,10aR)-3-hydroxy-1-(oxane-4-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[(3R,6aR,8S,10aR)-3-hydroxy-1-(oxane-4-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 54658373 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 2-[(3R,6aR,8S,10aR)-3-hydroxy-1-(oxane-4-carbonyl)-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1CC[C@@H]2[C@H](COC[C@H](O)CN2C(=O)C2CCOCC2)O1)NCc1ccncc1 |
| InChI | InChI=1S/C23H33N3O6/c27-18-13-26(23(29)17-5-9-30-10-6-17)20-2-1-19(32-21(20)15-31-14-18)11-22(28)25-12-16-3-7-24-8-4-16/h3-4,7-8,17-21,27H,1-2,5-6,9-15H2,(H,25,28)/t18-,19+,20-,21+/m1/s1 |
| InChIKey | AGSXXICWYLXCJA-MHTWAQMVSA-N |
| XLogP | 0.65 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |