C27H27FN2O2 — CID 54665589
1-[(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone (PubChem CID 54665589) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is 1-[(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 54665589 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-[(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
| SMILES | CN1c2ccc(-c3cccc(F)c3)cc2[C@@H]2[C@@H](CCN2C(=O)Cc2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C27H27FN2O2/c1-29-24-11-10-20(19-8-5-9-21(28)15-19)16-23(24)27-22(25(29)17-31)12-13-30(27)26(32)14-18-6-3-2-4-7-18/h2-11,15-16,22,25,27,31H,12-14,17H2,1H3/t22-,25-,27-/m0/s1 |
| InChIKey | LOOHRKFZWCKLPQ-LNBJVWSJSA-N |
| XLogP | 4.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |