C26H27ClN4O — CID 54670312
2-(13-benzyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl)-1-(4-chlorophenyl)ethanone (PubChem CID 54670312) has the molecular formula C26H27ClN4O and a molecular weight of 446.98 g/mol. Its IUPAC name is 2-(13-benzyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl)-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-(13-benzyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl)-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 54670312 |
| Molecular Formula | C26H27ClN4O |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-(13-benzyl-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl)-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(CN1CCC2CN(Cc3ccccc3)CCN2c2ncccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN4O/c27-22-10-8-21(9-11-22)25(32)19-30-14-12-23-18-29(17-20-5-2-1-3-6-20)15-16-31(23)26-24(30)7-4-13-28-26/h1-11,13,23H,12,14-19H2 |
| InChIKey | XDYMCBOKOILUGR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |