C27H34FN5O3 — CID 67001410
tert-butyl (2S)-2-[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-8-carbonyl]azetidine-1-carboxylate (PubChem CID 67001410) has the molecular formula C27H34FN5O3 and a molecular weight of 495.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-8-carbonyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-8-carbonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67001410 |
| Molecular Formula | C27H34FN5O3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | tert-butyl (2S)-2-[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-8-carbonyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)N1CCC2CN(Cc3ccc(F)cc3)CCN2c2ncccc21 |
| InChI | InChI=1S/C27H34FN5O3/c1-27(2,3)36-26(35)33-14-11-23(33)25(34)32-13-10-21-18-30(17-19-6-8-20(28)9-7-19)15-16-31(21)24-22(32)5-4-12-29-24/h4-9,12,21,23H,10-11,13-18H2,1-3H3/t21?,23-/m0/s1 |
| InChIKey | FWLCUZIMUVTMBZ-YANBTOMASA-N |
| XLogP | 3.66 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |