C12H12N2O3S — CID 54670646
[1-(4-methyl-1,3-thiazol-5-yl)-2-phenylethyl] nitrate (PubChem CID 54670646) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is [1-(4-methyl-1,3-thiazol-5-yl)-2-phenylethyl] nitrate.
| Compound Name | [1-(4-methyl-1,3-thiazol-5-yl)-2-phenylethyl] nitrate |
|---|---|
| PubChem CID | 54670646 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | [1-(4-methyl-1,3-thiazol-5-yl)-2-phenylethyl] nitrate |
| SMILES | Cc1ncsc1C(Cc1ccccc1)O[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O3S/c1-9-12(18-8-13-9)11(17-14(15)16)7-10-5-3-2-4-6-10/h2-6,8,11H,7H2,1H3 |
| InChIKey | VVNRSZWPVRHDSM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|