C23H25FN4O2S — CID 54672100
(1S,9S)-5-(4-fluorophenyl)-8-(4-methylphenyl)sulfonyl-2,3,4,8-tetrazatricyclo[7.5.0.02,6]tetradeca-3,5-diene (PubChem CID 54672100) has the molecular formula C23H25FN4O2S and a molecular weight of 440.54 g/mol. Its IUPAC name is (1S,9S)-5-(4-fluorophenyl)-8-(4-methylphenyl)sulfonyl-2,3,4,8-tetrazatricyclo[7.5.0.02,6]tetradeca-3,5-diene.
| Compound Name | (1S,9S)-5-(4-fluorophenyl)-8-(4-methylphenyl)sulfonyl-2,3,4,8-tetrazatricyclo[7.5.0.02,6]tetradeca-3,5-diene |
|---|---|
| PubChem CID | 54672100 |
| Molecular Formula | C23H25FN4O2S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (1S,9S)-5-(4-fluorophenyl)-8-(4-methylphenyl)sulfonyl-2,3,4,8-tetrazatricyclo[7.5.0.02,6]tetradeca-3,5-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(-c4ccc(F)cc4)nnn3[C@H]3CCCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C23H25FN4O2S/c1-16-7-13-19(14-8-16)31(29,30)27-15-22-23(17-9-11-18(24)12-10-17)25-26-28(22)21-6-4-2-3-5-20(21)27/h7-14,20-21H,2-6,15H2,1H3/t20-,21-/m0/s1 |
| InChIKey | FNSYGSBJRGKKPO-SFTDATJTSA-N |
| XLogP | 4.47 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |