C11H17N2O4+ — CID 54680398
(E)-3-hydroxy-1-[(1R,2R)-2-methoxycyclohexyl]oxy-1-oxobut-2-ene-2-diazonium (PubChem CID 54680398) has the molecular formula C11H17N2O4+ and a molecular weight of 241.27 g/mol. Its IUPAC name is (E)-3-hydroxy-1-[(1R,2R)-2-methoxycyclohexyl]oxy-1-oxobut-2-ene-2-diazonium.
| Compound Name | (E)-3-hydroxy-1-[(1R,2R)-2-methoxycyclohexyl]oxy-1-oxobut-2-ene-2-diazonium |
|---|---|
| PubChem CID | 54680398 |
| Molecular Formula | C11H17N2O4+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (E)-3-hydroxy-1-[(1R,2R)-2-methoxycyclohexyl]oxy-1-oxobut-2-ene-2-diazonium |
| SMILES | CO[C@@H]1CCCC[C@H]1OC(=O)/C([N+]#N)=C(/C)O |
| InChI | InChI=1S/C11H16N2O4/c1-7(14)10(13-12)11(15)17-9-6-4-3-5-8(9)16-2/h8-9H,3-6H2,1-2H3/p+1/t8-,9-/m1/s1 |
| InChIKey | XVJOYMMXURUDJA-RKDXNWHRSA-O |
| XLogP | 2.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|