C12H19Br2ClO2 — CID 5468043
[(E)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate (PubChem CID 5468043) has the molecular formula C12H19Br2ClO2 and a molecular weight of 390.54 g/mol. Its IUPAC name is [(E)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate.
| Compound Name | [(E)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate |
|---|---|
| PubChem CID | 5468043 |
| Molecular Formula | C12H19Br2ClO2 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | [(E)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(/CCl)CCC(Br)C(C)(C)Br |
| InChI | InChI=1S/C12H19Br2ClO2/c1-9(16)17-7-6-10(8-15)4-5-11(13)12(2,3)14/h6,11H,4-5,7-8H2,1-3H3/b10-6+ |
| InChIKey | CGRDTJCHEFNOHQ-UXBLZVDNSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|