C24H38Br4Cl2O4 — CID 6518121
[(Z)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate (PubChem CID 6518121) has the molecular formula C24H38Br4Cl2O4 and a molecular weight of 781.09 g/mol. Its IUPAC name is [(Z)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate.
| Compound Name | [(Z)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate |
|---|---|
| PubChem CID | 6518121 |
| Molecular Formula | C24H38Br4Cl2O4 |
| Molecular Weight | 781.09 g/mol |
| Exact Mass | 775.89 |
| IUPAC Name | [(Z)-6,7-dibromo-3-(chloromethyl)-7-methyloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\CCl)CCC(Br)C(C)(C)Br.CC(=O)OC/C=C(\CCl)CCC(Br)C(C)(C)Br |
| InChI | InChI=1S/2C12H19Br2ClO2/c2*1-9(16)17-7-6-10(8-15)4-5-11(13)12(2,3)14/h2*6,11H,4-5,7-8H2,1-3H3/b2*10-6- |
| InChIKey | ARMZUUZHULSRBM-VRGQSPJESA-N |
| XLogP | 8.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.09 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|