C14H21Br2ClO4 — CID 10983201
[(E,2S,3R,7R)-7-acetyloxy-2,8-dibromo-1-chloro-2,6-dimethyloct-5-en-3-yl] acetate (PubChem CID 10983201) has the molecular formula C14H21Br2ClO4 and a molecular weight of 448.58 g/mol. Its IUPAC name is [(E,2S,3R,7R)-7-acetyloxy-2,8-dibromo-1-chloro-2,6-dimethyloct-5-en-3-yl] acetate.
| Compound Name | [(E,2S,3R,7R)-7-acetyloxy-2,8-dibromo-1-chloro-2,6-dimethyloct-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 10983201 |
| Molecular Formula | C14H21Br2ClO4 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | [(E,2S,3R,7R)-7-acetyloxy-2,8-dibromo-1-chloro-2,6-dimethyloct-5-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](CBr)/C(C)=C/C[C@@H](OC(C)=O)[C@](C)(Br)CCl |
| InChI | InChI=1S/C14H21Br2ClO4/c1-9(12(7-15)20-10(2)18)5-6-13(21-11(3)19)14(4,16)8-17/h5,12-13H,6-8H2,1-4H3/b9-5+/t12-,13+,14+/m0/s1 |
| InChIKey | FHIJOUQVIUMTLH-BGZGZZQCSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|