C27H36N2O7Si — CID 54680972
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-7-(2-trimethylsilylethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54680972) has the molecular formula C27H36N2O7Si and a molecular weight of 528.68 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-7-(2-trimethylsilylethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-7-(2-trimethylsilylethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54680972 |
| Molecular Formula | C27H36N2O7Si |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-7-(2-trimethylsilylethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(CC[Si](C)(C)C)c4CC3CC2C(N(C)C)C1=O |
| InChI | InChI=1S/C27H36N2O7Si/c1-28-26(35)20-23(32)21(29(2)3)16-12-14-11-15-13(9-10-37(4,5)6)7-8-17(30)19(15)22(31)18(14)24(33)27(16,36)25(20)34/h7-8,14,16,21,30-31,34,36H,9-12H2,1-6H3,(H,28,35) |
| InChIKey | BNDNHFLSKWREMU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|