C28H32N2O11 — CID 54683182
[9-carbamoyl-7-(dimethylamino)-5,6,10,12-tetrahydroxy-5-methyl-8,11-dioxo-10a-propanoyloxy-5a,6,6a,7-tetrahydrotetracen-1-yl] propanoate (PubChem CID 54683182) has the molecular formula C28H32N2O11 and a molecular weight of 572.57 g/mol. Its IUPAC name is [9-carbamoyl-7-(dimethylamino)-5,6,10,12-tetrahydroxy-5-methyl-8,11-dioxo-10a-propanoyloxy-5a,6,6a,7-tetrahydrotetracen-1-yl] propanoate.
| Compound Name | [9-carbamoyl-7-(dimethylamino)-5,6,10,12-tetrahydroxy-5-methyl-8,11-dioxo-10a-propanoyloxy-5a,6,6a,7-tetrahydrotetracen-1-yl] propanoate |
|---|---|
| PubChem CID | 54683182 |
| Molecular Formula | C28H32N2O11 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | [9-carbamoyl-7-(dimethylamino)-5,6,10,12-tetrahydroxy-5-methyl-8,11-dioxo-10a-propanoyloxy-5a,6,6a,7-tetrahydrotetracen-1-yl] propanoate |
| SMILES | CCC(=O)Oc1cccc2c1C(O)=C1C(=O)C3(OC(=O)CC)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C1C2(C)O |
| InChI | InChI=1S/C28H32N2O11/c1-6-13(31)40-12-10-8-9-11-15(12)21(33)16-18(27(11,3)39)23(35)19-20(30(4)5)22(34)17(26(29)38)25(37)28(19,24(16)36)41-14(32)7-2/h8-10,18-20,23,33,35,37,39H,6-7H2,1-5H3,(H2,29,38) |
| InChIKey | BTJSJSBQJAWTLA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 213.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|