C26H28O5 — CID 54687944
methyl 3-[4-[cyclopropyl(phenyl)methyl]-3-hydroxy-5-oxo-2H-furan-2-yl]-5-phenylpentanoate (PubChem CID 54687944) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 3-[4-[cyclopropyl(phenyl)methyl]-3-hydroxy-5-oxo-2H-furan-2-yl]-5-phenylpentanoate.
| Compound Name | methyl 3-[4-[cyclopropyl(phenyl)methyl]-3-hydroxy-5-oxo-2H-furan-2-yl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 54687944 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | methyl 3-[4-[cyclopropyl(phenyl)methyl]-3-hydroxy-5-oxo-2H-furan-2-yl]-5-phenylpentanoate |
| SMILES | COC(=O)CC(CCc1ccccc1)C1OC(=O)C(C(c2ccccc2)C2CC2)=C1O |
| InChI | InChI=1S/C26H28O5/c1-30-21(27)16-20(13-12-17-8-4-2-5-9-17)25-24(28)23(26(29)31-25)22(19-14-15-19)18-10-6-3-7-11-18/h2-11,19-20,22,25,28H,12-16H2,1H3 |
| InChIKey | GMVGWTPZMYHGOW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |