C20H23ClO4 — CID 70121398
6-(1-chloropentan-3-yl)-3-[cyclopropyl(phenyl)methyl]-4-hydroxypyran-2,5-dione (PubChem CID 70121398) has the molecular formula C20H23ClO4 and a molecular weight of 362.85 g/mol. Its IUPAC name is 6-(1-chloropentan-3-yl)-3-[cyclopropyl(phenyl)methyl]-4-hydroxypyran-2,5-dione.
| Compound Name | 6-(1-chloropentan-3-yl)-3-[cyclopropyl(phenyl)methyl]-4-hydroxypyran-2,5-dione |
|---|---|
| PubChem CID | 70121398 |
| Molecular Formula | C20H23ClO4 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 6-(1-chloropentan-3-yl)-3-[cyclopropyl(phenyl)methyl]-4-hydroxypyran-2,5-dione |
| SMILES | CCC(CCCl)C1OC(=O)C(C(c2ccccc2)C2CC2)=C(O)C1=O |
| InChI | InChI=1S/C20H23ClO4/c1-2-12(10-11-21)19-18(23)17(22)16(20(24)25-19)15(14-8-9-14)13-6-4-3-5-7-13/h3-7,12,14-15,19,22H,2,8-11H2,1H3 |
| InChIKey | XNCMYUIIPPIPGB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|