C20H17N3O4 — CID 54688277
10-(2,3-dihydroindole-1-carbonyl)-9-hydroxy-6-methoxy-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 54688277) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 10-(2,3-dihydroindole-1-carbonyl)-9-hydroxy-6-methoxy-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 10-(2,3-dihydroindole-1-carbonyl)-9-hydroxy-6-methoxy-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 54688277 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 10-(2,3-dihydroindole-1-carbonyl)-9-hydroxy-6-methoxy-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | COc1cc2c3c(c1)c(O)c(C(=O)N1CCc4ccccc41)c(=O)n3NC2 |
| InChI | InChI=1S/C20H17N3O4/c1-27-13-8-12-10-21-23-17(12)14(9-13)18(24)16(20(23)26)19(25)22-7-6-11-4-2-3-5-15(11)22/h2-5,8-9,21,24H,6-7,10H2,1H3 |
| InChIKey | SEJGOLUVSWKGGX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |