C25H30O3S — CID 54688990
2-hexyl-4-hydroxy-2-phenyl-5-(2-phenylethylsulfanyl)-3H-pyran-6-one (PubChem CID 54688990) has the molecular formula C25H30O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 2-hexyl-4-hydroxy-2-phenyl-5-(2-phenylethylsulfanyl)-3H-pyran-6-one.
| Compound Name | 2-hexyl-4-hydroxy-2-phenyl-5-(2-phenylethylsulfanyl)-3H-pyran-6-one |
|---|---|
| PubChem CID | 54688990 |
| Molecular Formula | C25H30O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-hexyl-4-hydroxy-2-phenyl-5-(2-phenylethylsulfanyl)-3H-pyran-6-one |
| SMILES | CCCCCCC1(c2ccccc2)CC(O)=C(SCCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C25H30O3S/c1-2-3-4-11-17-25(21-14-9-6-10-15-21)19-22(26)23(24(27)28-25)29-18-16-20-12-7-5-8-13-20/h5-10,12-15,26H,2-4,11,16-19H2,1H3 |
| InChIKey | VDLUNTPWHJULPS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|