C23H26O3 — CID 54721641
5-benzyl-4-hydroxy-2-(3-methylbutyl)-2-phenyl-3H-pyran-6-one (PubChem CID 54721641) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 5-benzyl-4-hydroxy-2-(3-methylbutyl)-2-phenyl-3H-pyran-6-one.
| Compound Name | 5-benzyl-4-hydroxy-2-(3-methylbutyl)-2-phenyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 54721641 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-benzyl-4-hydroxy-2-(3-methylbutyl)-2-phenyl-3H-pyran-6-one |
| SMILES | CC(C)CCC1(c2ccccc2)CC(O)=C(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C23H26O3/c1-17(2)13-14-23(19-11-7-4-8-12-19)16-21(24)20(22(25)26-23)15-18-9-5-3-6-10-18/h3-12,17,24H,13-16H2,1-2H3 |
| InChIKey | QKIJZIHLXFSLPF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |