C28H29NO3 — CID 54711644
5-[(3-aminophenyl)methyl]-4-hydroxy-2,2-bis(2-phenylethyl)-3H-pyran-6-one (PubChem CID 54711644) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 5-[(3-aminophenyl)methyl]-4-hydroxy-2,2-bis(2-phenylethyl)-3H-pyran-6-one.
| Compound Name | 5-[(3-aminophenyl)methyl]-4-hydroxy-2,2-bis(2-phenylethyl)-3H-pyran-6-one |
|---|---|
| PubChem CID | 54711644 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-[(3-aminophenyl)methyl]-4-hydroxy-2,2-bis(2-phenylethyl)-3H-pyran-6-one |
| SMILES | Nc1cccc(CC2=C(O)CC(CCc3ccccc3)(CCc3ccccc3)OC2=O)c1 |
| InChI | InChI=1S/C28H29NO3/c29-24-13-7-12-23(18-24)19-25-26(30)20-28(32-27(25)31,16-14-21-8-3-1-4-9-21)17-15-22-10-5-2-6-11-22/h1-13,18,30H,14-17,19-20,29H2 |
| InChIKey | GURIBSPXGMTTHQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|