C12H18N2O2 — CID 5469016
(E)-1,4-dipyrrolidin-1-ylbut-2-ene-1,4-dione (PubChem CID 5469016) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (E)-1,4-dipyrrolidin-1-ylbut-2-ene-1,4-dione.
| Compound Name | (E)-1,4-dipyrrolidin-1-ylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 5469016 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (E)-1,4-dipyrrolidin-1-ylbut-2-ene-1,4-dione |
| SMILES | O=C(/C=C/C(=O)N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C12H18N2O2/c15-11(13-7-1-2-8-13)5-6-12(16)14-9-3-4-10-14/h5-6H,1-4,7-10H2/b6-5+ |
| InChIKey | MZYNGCZLDUSQKA-AATRIKPKSA-N |
| XLogP | 0.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|