C17H20O3 — CID 54690707
2-(cyclopentylmethyl)-4-hydroxy-2-phenyl-3H-pyran-6-one (PubChem CID 54690707) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-4-hydroxy-2-phenyl-3H-pyran-6-one.
| Compound Name | 2-(cyclopentylmethyl)-4-hydroxy-2-phenyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 54690707 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(cyclopentylmethyl)-4-hydroxy-2-phenyl-3H-pyran-6-one |
| SMILES | O=C1C=C(O)CC(CC2CCCC2)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H20O3/c18-15-10-16(19)20-17(12-15,11-13-6-4-5-7-13)14-8-2-1-3-9-14/h1-3,8-10,13,18H,4-7,11-12H2 |
| InChIKey | LUQSZGJFVAYSEF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |