C20H16ClNO2 — CID 54691172
8-(4-chlorophenyl)-7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 54691172) has the molecular formula C20H16ClNO2 and a molecular weight of 337.81 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one.
| Compound Name | 8-(4-chlorophenyl)-7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 54691172 |
| Molecular Formula | C20H16ClNO2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 8-(4-chlorophenyl)-7-hydroxy-6-phenyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | O=c1c(-c2ccccc2)c(O)c(-c2ccc(Cl)cc2)c2n1CCC2 |
| InChI | InChI=1S/C20H16ClNO2/c21-15-10-8-14(9-11-15)17-16-7-4-12-22(16)20(24)18(19(17)23)13-5-2-1-3-6-13/h1-3,5-6,8-11,23H,4,7,12H2 |
| InChIKey | VXUAQDNSVWBWPD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |